| Stereochemistry | ABSOLUTE |
| Molecular Formula | C14H25N3O9.ClH |
| Molecular Weight | 415.824 |
| Optical Activity | UNSPECIFIED |
| Defined Stereocenters | 10 / 10 |
| E/Z Centers | 0 |
| Charge | 0 |
SHOW SMILES / InChI
SMILES
Cl.C[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)[C@H]2O)[C@@H](N)C[C@@H]1NC(=N)C(O)=O
InChI
InChIKey=ZDRBJJNXJOSCLR-NZXABURVSA-N
InChI=1S/C14H25N3O9.ClH/c1-3-5(17-12(16)13(23)24)2-4(15)14(25-3)26-11-9(21)7(19)6(18)8(20)10(11)22;/h3-11,14,18-22H,2,15H2,1H3,(H2,16,17)(H,23,24);1H/t3-,4+,5+,6-,7+,8+,9-,10+,11+,14-;/m1./s1
| Molecular Formula | ClH |
| Molecular Weight | 36.461 |
| Charge | 0 |
| Count |
MOL RATIO
1 MOL RATIO (average) |
| Stereochemistry | ACHIRAL |
| Additional Stereochemistry | No |
| Defined Stereocenters | 0 / 0 |
| E/Z Centers | 0 |
| Optical Activity | NONE |
| Molecular Formula | C14H25N3O9 |
| Molecular Weight | 379.363 |
| Charge | 0 |
| Count |
MOL RATIO
1 MOL RATIO (average) |
| Stereochemistry | ABSOLUTE |
| Additional Stereochemistry | No |
| Defined Stereocenters | 10 / 10 |
| E/Z Centers | 0 |
| Optical Activity | UNSPECIFIED |
Kasugamycin, an aminoglycoside antibiotic, potently inhibits both gram-positive and gram-negative bacteria, binds to the 30S subunit of the bacterial ribosome, and suppresses protein synthesis. Kasugamycin was studied in clinical use for urinary tract infections due to Pseudomonas aeruginosa and was investigated its therapeutic effect on respiratory infections due to Pseudomonas aeruginosa. Experiments in vitro showed that kasugamycin did not have any appreciable effect against a variety of bacteria tested. The only exceptions were several species of gram-negative bacteria, against which antibiotics that are more satisfactory already exist. That is why further evaluation of kasugamycin for potential human use as an antipseudomonal was discontinued.
Originator
Approval Year
Sample Use Guides
The median minimal inhibitory concentration (MIC) of the Pseudomonas strains tested was 250 mug/ml and the bactericidal level was 500 mug/ml. Kasugamycin was found to be slightly more active in a more basic medium (Mycin Assay broth) in which the median MIC for 11 Pseudomonas strains was 125 mug/ml. Kasugamycin manifests a modest degree of serum binding. Kasugamycin did not have any appreciable effect against a variety of bacteria tested. The only exceptions were several species of gram-negative bacteria, against which more satisfactory antibiotics already exist.
